C11H10N4O2S2 — CID 106545998
2-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 106545998) has the molecular formula C11H10N4O2S2 and a molecular weight of 294.36 g/mol. Its IUPAC name is 2-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106545998 |
| Molecular Formula | C11H10N4O2S2 |
| Molecular Weight | 294.36 g/mol |
| Exact Mass | 294.02 |
| IUPAC Name | 2-cyano-N-[1-(1,3-thiazol-2-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cccnc1C#N)c1nccs1 |
| InChI | InChI=1S/C11H10N4O2S2/c1-8(11-14-5-6-18-11)15-19(16,17)10-3-2-4-13-9(10)7-12/h2-6,8,15H,1H3 |
| InChIKey | AXILAUXSFWLQNF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |