C11H15N3O3S2 — CID 106596242
2-cyano-N-(4-methylsulfinylbutan-2-yl)pyridine-3-sulfonamide (PubChem CID 106596242) has the molecular formula C11H15N3O3S2 and a molecular weight of 301.39 g/mol. Its IUPAC name is 2-cyano-N-(4-methylsulfinylbutan-2-yl)pyridine-3-sulfonamide.
| Compound Name | 2-cyano-N-(4-methylsulfinylbutan-2-yl)pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 106596242 |
| Molecular Formula | C11H15N3O3S2 |
| Molecular Weight | 301.39 g/mol |
| Exact Mass | 301.06 |
| IUPAC Name | 2-cyano-N-(4-methylsulfinylbutan-2-yl)pyridine-3-sulfonamide |
| SMILES | CC(CCS(C)=O)NS(=O)(=O)c1cccnc1C#N |
| InChI | InChI=1S/C11H15N3O3S2/c1-9(5-7-18(2)15)14-19(16,17)11-4-3-6-13-10(11)8-12/h3-4,6,9,14H,5,7H2,1-2H3 |
| InChIKey | KSHRVKHKOQVGGC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 99.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.39 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |