C12H19NO5S2 — CID 81077958
2-[(5-ethylthiophen-2-yl)sulfonylamino]-5-methoxypentanoic acid (PubChem CID 81077958) has the molecular formula C12H19NO5S2 and a molecular weight of 321.42 g/mol. Its IUPAC name is 2-[(5-ethylthiophen-2-yl)sulfonylamino]-5-methoxypentanoic acid.
| Compound Name | 2-[(5-ethylthiophen-2-yl)sulfonylamino]-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 81077958 |
| Molecular Formula | C12H19NO5S2 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.07 |
| IUPAC Name | 2-[(5-ethylthiophen-2-yl)sulfonylamino]-5-methoxypentanoic acid |
| SMILES | CCc1ccc(S(=O)(=O)NC(CCCOC)C(=O)O)s1 |
| InChI | InChI=1S/C12H19NO5S2/c1-3-9-6-7-11(19-9)20(16,17)13-10(12(14)15)5-4-8-18-2/h6-7,10,13H,3-5,8H2,1-2H3,(H,14,15) |
| InChIKey | RADGIQRYLAXGGF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|