C10H15NO5S2 — CID 62478448
4-methoxy-2-[(5-methylthiophen-2-yl)sulfonylamino]butanoic acid (PubChem CID 62478448) has the molecular formula C10H15NO5S2 and a molecular weight of 293.37 g/mol. Its IUPAC name is 4-methoxy-2-[(5-methylthiophen-2-yl)sulfonylamino]butanoic acid.
| Compound Name | 4-methoxy-2-[(5-methylthiophen-2-yl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 62478448 |
| Molecular Formula | C10H15NO5S2 |
| Molecular Weight | 293.37 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 4-methoxy-2-[(5-methylthiophen-2-yl)sulfonylamino]butanoic acid |
| SMILES | COCCC(NS(=O)(=O)c1ccc(C)s1)C(=O)O |
| InChI | InChI=1S/C10H15NO5S2/c1-7-3-4-9(17-7)18(14,15)11-8(10(12)13)5-6-16-2/h3-4,8,11H,5-6H2,1-2H3,(H,12,13) |
| InChIKey | OMTIRYVXMAPWLM-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.37 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |