C9H12BrNO5S2 — CID 62478980
2-[(3-bromothiophen-2-yl)sulfonylamino]-4-methoxybutanoic acid (PubChem CID 62478980) has the molecular formula C9H12BrNO5S2 and a molecular weight of 358.24 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)sulfonylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 62478980 |
| Molecular Formula | C9H12BrNO5S2 |
| Molecular Weight | 358.24 g/mol |
| Exact Mass | 356.93 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)sulfonylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NS(=O)(=O)c1sccc1Br)C(=O)O |
| InChI | InChI=1S/C9H12BrNO5S2/c1-16-4-2-7(8(12)13)11-18(14,15)9-6(10)3-5-17-9/h3,5,7,11H,2,4H2,1H3,(H,12,13) |
| InChIKey | FHVVCOJZHIWZIQ-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.24 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |