C9H11BrN2O5S2 — CID 61063305
5-amino-2-[(3-bromothiophen-2-yl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 61063305) has the molecular formula C9H11BrN2O5S2 and a molecular weight of 371.23 g/mol. Its IUPAC name is 5-amino-2-[(3-bromothiophen-2-yl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(3-bromothiophen-2-yl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61063305 |
| Molecular Formula | C9H11BrN2O5S2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | 5-amino-2-[(3-bromothiophen-2-yl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NS(=O)(=O)c1sccc1Br)C(=O)O |
| InChI | InChI=1S/C9H11BrN2O5S2/c10-5-3-4-18-9(5)19(16,17)12-6(8(14)15)1-2-7(11)13/h3-4,6,12H,1-2H2,(H2,11,13)(H,14,15) |
| InChIKey | RYDLWLNSLZOYQX-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |