C11H12F2N2O5S — CID 61141194
(2S)-5-amino-2-[(2,5-difluorophenyl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 61141194) has the molecular formula C11H12F2N2O5S and a molecular weight of 322.29 g/mol. Its IUPAC name is (2S)-5-amino-2-[(2,5-difluorophenyl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(2,5-difluorophenyl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61141194 |
| Molecular Formula | C11H12F2N2O5S |
| Molecular Weight | 322.29 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | (2S)-5-amino-2-[(2,5-difluorophenyl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CC[C@H](NS(=O)(=O)c1cc(F)ccc1F)C(=O)O |
| InChI | InChI=1S/C11H12F2N2O5S/c12-6-1-2-7(13)9(5-6)21(19,20)15-8(11(17)18)3-4-10(14)16/h1-2,5,8,15H,3-4H2,(H2,14,16)(H,17,18)/t8-/m0/s1 |
| InChIKey | LZVMRYQRGOQDIU-QMMMGPOBSA-N |
| XLogP | -0.04 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.29 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |