C11H12ClFN2O5S — CID 43245034
5-amino-2-[(2-chloro-4-fluorophenyl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 43245034) has the molecular formula C11H12ClFN2O5S and a molecular weight of 338.74 g/mol. Its IUPAC name is 5-amino-2-[(2-chloro-4-fluorophenyl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | 5-amino-2-[(2-chloro-4-fluorophenyl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 43245034 |
| Molecular Formula | C11H12ClFN2O5S |
| Molecular Weight | 338.74 g/mol |
| Exact Mass | 338.01 |
| IUPAC Name | 5-amino-2-[(2-chloro-4-fluorophenyl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | NC(=O)CCC(NS(=O)(=O)c1ccc(F)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12ClFN2O5S/c12-7-5-6(13)1-3-9(7)21(19,20)15-8(11(17)18)2-4-10(14)16/h1,3,5,8,15H,2,4H2,(H2,14,16)(H,17,18) |
| InChIKey | WWEVSKUVDLWYSV-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.74 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |