C12H15FN2O5S — CID 104935522
(2R)-5-amino-2-[(2-fluoro-5-methylphenyl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 104935522) has the molecular formula C12H15FN2O5S and a molecular weight of 318.33 g/mol. Its IUPAC name is (2R)-5-amino-2-[(2-fluoro-5-methylphenyl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-[(2-fluoro-5-methylphenyl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 104935522 |
| Molecular Formula | C12H15FN2O5S |
| Molecular Weight | 318.33 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | (2R)-5-amino-2-[(2-fluoro-5-methylphenyl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | Cc1ccc(F)c(S(=O)(=O)N[C@H](CCC(N)=O)C(=O)O)c1 |
| InChI | InChI=1S/C12H15FN2O5S/c1-7-2-3-8(13)10(6-7)21(19,20)15-9(12(17)18)4-5-11(14)16/h2-3,6,9,15H,4-5H2,1H3,(H2,14,16)(H,17,18)/t9-/m1/s1 |
| InChIKey | PZVXZRKHMWHFRE-SECBINFHSA-N |
| XLogP | 0.13 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.33 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |