C12H15BrN2O5S — CID 61141460
(2S)-5-amino-2-[(4-bromo-3-methylphenyl)sulfonylamino]-5-oxopentanoic acid (PubChem CID 61141460) has the molecular formula C12H15BrN2O5S and a molecular weight of 379.23 g/mol. Its IUPAC name is (2S)-5-amino-2-[(4-bromo-3-methylphenyl)sulfonylamino]-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-[(4-bromo-3-methylphenyl)sulfonylamino]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 61141460 |
| Molecular Formula | C12H15BrN2O5S |
| Molecular Weight | 379.23 g/mol |
| Exact Mass | 377.99 |
| IUPAC Name | (2S)-5-amino-2-[(4-bromo-3-methylphenyl)sulfonylamino]-5-oxopentanoic acid |
| SMILES | Cc1cc(S(=O)(=O)N[C@@H](CCC(N)=O)C(=O)O)ccc1Br |
| InChI | InChI=1S/C12H15BrN2O5S/c1-7-6-8(2-3-9(7)13)21(19,20)15-10(12(17)18)4-5-11(14)16/h2-3,6,10,15H,4-5H2,1H3,(H2,14,16)(H,17,18)/t10-/m0/s1 |
| InChIKey | OALMNZSXOKNZJR-JTQLQIEISA-N |
| XLogP | 0.75 |
| TPSA | 126.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.23 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |