C12H16BrNO4S — CID 80540369
4-[(4-bromo-3-methylphenyl)sulfonylamino]-2-methylbutanoic acid (PubChem CID 80540369) has the molecular formula C12H16BrNO4S and a molecular weight of 350.23 g/mol. Its IUPAC name is 4-[(4-bromo-3-methylphenyl)sulfonylamino]-2-methylbutanoic acid.
| Compound Name | 4-[(4-bromo-3-methylphenyl)sulfonylamino]-2-methylbutanoic acid |
|---|---|
| PubChem CID | 80540369 |
| Molecular Formula | C12H16BrNO4S |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 349.00 |
| IUPAC Name | 4-[(4-bromo-3-methylphenyl)sulfonylamino]-2-methylbutanoic acid |
| SMILES | Cc1cc(S(=O)(=O)NCCC(C)C(=O)O)ccc1Br |
| InChI | InChI=1S/C12H16BrNO4S/c1-8(12(15)16)5-6-14-19(17,18)10-3-4-11(13)9(2)7-10/h3-4,7-8,14H,5-6H2,1-2H3,(H,15,16) |
| InChIKey | HEQJIOSQZDFCFN-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |