C13H17N2O5S- — CID 2101775
(2R)-5-amino-2-[(2,4-dimethylphenyl)sulfonylamino]-5-oxopentanoate (PubChem CID 2101775) has the molecular formula C13H17N2O5S- and a molecular weight of 313.36 g/mol. Its IUPAC name is (2R)-5-amino-2-[(2,4-dimethylphenyl)sulfonylamino]-5-oxopentanoate.
| Compound Name | (2R)-5-amino-2-[(2,4-dimethylphenyl)sulfonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 2101775 |
| Molecular Formula | C13H17N2O5S- |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.09 |
| IUPAC Name | (2R)-5-amino-2-[(2,4-dimethylphenyl)sulfonylamino]-5-oxopentanoate |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H](CCC(N)=O)C(=O)[O-])c(C)c1 |
| InChI | InChI=1S/C13H18N2O5S/c1-8-3-5-11(9(2)7-8)21(19,20)15-10(13(17)18)4-6-12(14)16/h3,5,7,10,15H,4,6H2,1-2H3,(H2,14,16)(H,17,18)/p-1/t10-/m1/s1 |
| InChIKey | XRCFYLHXXLSTTD-SNVBAGLBSA-M |
| XLogP | -1.03 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |