C11H12FN2O5S- — CID 9403798
(2R)-5-amino-2-[(4-fluorophenyl)sulfonylamino]-5-oxopentanoate (PubChem CID 9403798) has the molecular formula C11H12FN2O5S- and a molecular weight of 303.29 g/mol. Its IUPAC name is (2R)-5-amino-2-[(4-fluorophenyl)sulfonylamino]-5-oxopentanoate.
| Compound Name | (2R)-5-amino-2-[(4-fluorophenyl)sulfonylamino]-5-oxopentanoate |
|---|---|
| PubChem CID | 9403798 |
| Molecular Formula | C11H12FN2O5S- |
| Molecular Weight | 303.29 g/mol |
| Exact Mass | 303.05 |
| IUPAC Name | (2R)-5-amino-2-[(4-fluorophenyl)sulfonylamino]-5-oxopentanoate |
| SMILES | NC(=O)CC[C@@H](NS(=O)(=O)c1ccc(F)cc1)C(=O)[O-] |
| InChI | InChI=1S/C11H13FN2O5S/c12-7-1-3-8(4-2-7)20(18,19)14-9(11(16)17)5-6-10(13)15/h1-4,9,14H,5-6H2,(H2,13,15)(H,16,17)/p-1/t9-/m1/s1 |
| InChIKey | NSBQHFOSBZVZBB-SECBINFHSA-M |
| XLogP | -1.51 |
| TPSA | 129.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.29 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |