C15H13FNNaO4S — CID 139844001
sodium (2S)-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 139844001) has the molecular formula C15H13FNNaO4S and a molecular weight of 345.33 g/mol. Its IUPAC name is sodium (2S)-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | sodium (2S)-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 139844001 |
| Molecular Formula | C15H13FNNaO4S |
| Molecular Weight | 345.33 g/mol |
| Exact Mass | 345.04 |
| IUPAC Name | sodium (2S)-2-[(4-fluorophenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | O=C([O-])[C@H](Cc1ccccc1)NS(=O)(=O)c1ccc(F)cc1.[Na+] |
| InChI | InChI=1S/C15H14FNO4S.Na/c16-12-6-8-13(9-7-12)22(20,21)17-14(15(18)19)10-11-4-2-1-3-5-11;/h1-9,14,17H,10H2,(H,18,19);/q;+1/p-1/t14-;/m0./s1 |
| InChIKey | MNCUGDKWCMKGTF-UQKRIMTDSA-M |
| XLogP | -2.53 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.33 |
| LogP ≤ 5 | -2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |