C15H15N2O4S- — CID 6942145
(2R)-2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoate (PubChem CID 6942145) has the molecular formula C15H15N2O4S- and a molecular weight of 319.36 g/mol. Its IUPAC name is (2R)-2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoate.
| Compound Name | (2R)-2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 6942145 |
| Molecular Formula | C15H15N2O4S- |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (2R)-2-[(4-aminophenyl)sulfonylamino]-3-phenylpropanoate |
| SMILES | Nc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)[O-])cc1 |
| InChI | InChI=1S/C15H16N2O4S/c16-12-6-8-13(9-7-12)22(20,21)17-14(15(18)19)10-11-4-2-1-3-5-11/h1-9,14,17H,10,16H2,(H,18,19)/p-1/t14-/m1/s1 |
| InChIKey | AAWOKTGNZABRTQ-CQSZACIVSA-M |
| XLogP | -0.09 |
| TPSA | 112.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|