C16H16FNO3S — CID 175585401
2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl fluoride (PubChem CID 175585401) has the molecular formula C16H16FNO3S and a molecular weight of 321.37 g/mol. Its IUPAC name is 2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl fluoride.
| Compound Name | 2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl fluoride |
|---|---|
| PubChem CID | 175585401 |
| Molecular Formula | C16H16FNO3S |
| Molecular Weight | 321.37 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoyl fluoride |
| SMILES | Cc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)F)cc1 |
| InChI | InChI=1S/C16H16FNO3S/c1-12-7-9-14(10-8-12)22(20,21)18-15(16(17)19)11-13-5-3-2-4-6-13/h2-10,15,18H,11H2,1H3 |
| InChIKey | CFLXOQLPIDMRHA-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.37 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|