C18H20ClNO5S — CID 87106127
2-chloroacetaldehyde;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid (PubChem CID 87106127) has the molecular formula C18H20ClNO5S and a molecular weight of 397.88 g/mol. Its IUPAC name is 2-chloroacetaldehyde;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-chloroacetaldehyde;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 87106127 |
| Molecular Formula | C18H20ClNO5S |
| Molecular Weight | 397.88 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 2-chloroacetaldehyde;(2S)-2-[(4-methylphenyl)sulfonylamino]-3-phenylpropanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc1.O=CCCl |
| InChI | InChI=1S/C16H17NO4S.C2H3ClO/c1-12-7-9-14(10-8-12)22(20,21)17-15(16(18)19)11-13-5-3-2-4-6-13;3-1-2-4/h2-10,15,17H,11H2,1H3,(H,18,19);2H,1H2/t15-;/m0./s1 |
| InChIKey | GSLCYBAANVKSSM-RSAXXLAASA-N |
| XLogP | 2.39 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.88 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|