C10H12NO4S- — CID 6944962
(2S)-2-(benzenesulfonamido)butanoate (PubChem CID 6944962) has the molecular formula C10H12NO4S- and a molecular weight of 242.28 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)butanoate.
| Compound Name | (2S)-2-(benzenesulfonamido)butanoate |
|---|---|
| PubChem CID | 6944962 |
| Molecular Formula | C10H12NO4S- |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)butanoate |
| SMILES | CC[C@H](NS(=O)(=O)c1ccccc1)C(=O)[O-] |
| InChI | InChI=1S/C10H13NO4S/c1-2-9(10(12)13)11-16(14,15)8-6-4-3-5-7-8/h3-7,9,11H,2H2,1H3,(H,12,13)/p-1/t9-/m0/s1 |
| InChIKey | QHDGPWMINFIDFP-VIFPVBQESA-M |
| XLogP | -0.51 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |