C14H14NO4S- — CID 6923633
(2R)-2-(naphthalen-2-ylsulfonylamino)butanoate (PubChem CID 6923633) has the molecular formula C14H14NO4S- and a molecular weight of 292.34 g/mol. Its IUPAC name is (2R)-2-(naphthalen-2-ylsulfonylamino)butanoate.
| Compound Name | (2R)-2-(naphthalen-2-ylsulfonylamino)butanoate |
|---|---|
| PubChem CID | 6923633 |
| Molecular Formula | C14H14NO4S- |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.06 |
| IUPAC Name | (2R)-2-(naphthalen-2-ylsulfonylamino)butanoate |
| SMILES | CC[C@@H](NS(=O)(=O)c1ccc2ccccc2c1)C(=O)[O-] |
| InChI | InChI=1S/C14H15NO4S/c1-2-13(14(16)17)15-20(18,19)12-8-7-10-5-3-4-6-11(10)9-12/h3-9,13,15H,2H2,1H3,(H,16,17)/p-1/t13-/m1/s1 |
| InChIKey | JHMNSCZBIJSNRA-CYBMUJFWSA-M |
| XLogP | 0.65 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |