C13H15ClN2O4S — CID 70154426
(2S)-3-amino-2-(naphthalen-2-ylsulfonylamino)propanoic acid;hydrochloride (PubChem CID 70154426) has the molecular formula C13H15ClN2O4S and a molecular weight of 330.79 g/mol. Its IUPAC name is (2S)-3-amino-2-(naphthalen-2-ylsulfonylamino)propanoic acid;hydrochloride.
| Compound Name | (2S)-3-amino-2-(naphthalen-2-ylsulfonylamino)propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 70154426 |
| Molecular Formula | C13H15ClN2O4S |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (2S)-3-amino-2-(naphthalen-2-ylsulfonylamino)propanoic acid;hydrochloride |
| SMILES | Cl.NC[C@H](NS(=O)(=O)c1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C13H14N2O4S.ClH/c14-8-12(13(16)17)15-20(18,19)11-6-5-9-3-1-2-4-10(9)7-11;/h1-7,12,15H,8,14H2,(H,16,17);1H/t12-;/m0./s1 |
| InChIKey | TWAVURHMAFIALS-YDALLXLXSA-N |
| XLogP | 0.95 |
| TPSA | 109.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |