C19H17NO5S — CID 1083656
(2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoic acid (PubChem CID 1083656) has the molecular formula C19H17NO5S and a molecular weight of 371.41 g/mol. Its IUPAC name is (2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoic acid.
| Compound Name | (2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 1083656 |
| Molecular Formula | C19H17NO5S |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | (2R,3S)-3-hydroxy-2-(naphthalen-2-ylsulfonylamino)-3-phenylpropanoic acid |
| SMILES | O=C(O)[C@H](NS(=O)(=O)c1ccc2ccccc2c1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C19H17NO5S/c21-18(14-7-2-1-3-8-14)17(19(22)23)20-26(24,25)16-11-10-13-6-4-5-9-15(13)12-16/h1-12,17-18,20-21H,(H,22,23)/t17-,18+/m1/s1 |
| InChIKey | HNRPARUHQYYJCO-MSOLQXFVSA-N |
| XLogP | 2.30 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |