C30H28N2O2RuS — CID 87738093
N-[(1R,2R)-2-amino-1,2-diphenylethyl]naphthalene-2-sulfonamide;benzene;ruthenium (PubChem CID 87738093) has the molecular formula C30H28N2O2RuS and a molecular weight of 581.70 g/mol. Its IUPAC name is N-[(1R,2R)-2-amino-1,2-diphenylethyl]naphthalene-2-sulfonamide;benzene;ruthenium.
| Compound Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]naphthalene-2-sulfonamide;benzene;ruthenium |
|---|---|
| PubChem CID | 87738093 |
| Molecular Formula | C30H28N2O2RuS |
| Molecular Weight | 581.70 g/mol |
| Exact Mass | 582.09 |
| IUPAC Name | N-[(1R,2R)-2-amino-1,2-diphenylethyl]naphthalene-2-sulfonamide;benzene;ruthenium |
| SMILES | N[C@H](c1ccccc1)[C@H](NS(=O)(=O)c1ccc2ccccc2c1)c1ccccc1.[Ru].c1ccccc1 |
| InChI | InChI=1S/C24H22N2O2S.C6H6.Ru/c25-23(19-10-3-1-4-11-19)24(20-12-5-2-6-13-20)26-29(27,28)22-16-15-18-9-7-8-14-21(18)17-22;1-2-4-6-5-3-1;/h1-17,23-24,26H,25H2;1-6H;/t23-,24-;;/m1../s1 |
| InChIKey | RKPQDSFYEHYGGO-NILKIKDOSA-N |
| XLogP | 6.24 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.70 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |