C24H21NO3S — CID 1259617
N-[(S)-(4-methoxyphenyl)-phenylmethyl]naphthalene-2-sulfonamide (PubChem CID 1259617) has the molecular formula C24H21NO3S and a molecular weight of 403.50 g/mol. Its IUPAC name is N-[(S)-(4-methoxyphenyl)-phenylmethyl]naphthalene-2-sulfonamide.
| Compound Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]naphthalene-2-sulfonamide |
|---|---|
| PubChem CID | 1259617 |
| Molecular Formula | C24H21NO3S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.12 |
| IUPAC Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]naphthalene-2-sulfonamide |
| SMILES | COc1ccc([C@@H](NS(=O)(=O)c2ccc3ccccc3c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21NO3S/c1-28-22-14-11-20(12-15-22)24(19-8-3-2-4-9-19)25-29(26,27)23-16-13-18-7-5-6-10-21(18)17-23/h2-17,24-25H,1H3/t24-/m0/s1 |
| InChIKey | VWVNSAGWEJZTQB-DEOSSOPVSA-N |
| XLogP | 4.92 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |