C23H21NO4S — CID 134953908
N-[(R)-1-benzofuran-2-yl-(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide (PubChem CID 134953908) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is N-[(R)-1-benzofuran-2-yl-(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[(R)-1-benzofuran-2-yl-(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 134953908 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | N-[(R)-1-benzofuran-2-yl-(4-methoxyphenyl)methyl]-4-methylbenzenesulfonamide |
| SMILES | COc1ccc([C@@H](NS(=O)(=O)c2ccc(C)cc2)c2cc3ccccc3o2)cc1 |
| InChI | InChI=1S/C23H21NO4S/c1-16-7-13-20(14-8-16)29(25,26)24-23(17-9-11-19(27-2)12-10-17)22-15-18-5-3-4-6-21(18)28-22/h3-15,23-24H,1-2H3/t23-/m1/s1 |
| InChIKey | QPLXAEVZHMBWLW-HSZRJFAPSA-N |
| XLogP | 4.82 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |