C22H21N5O3S — CID 51687107
N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-methyl-4-(tetrazol-1-yl)benzenesulfonamide (PubChem CID 51687107) has the molecular formula C22H21N5O3S and a molecular weight of 435.51 g/mol. Its IUPAC name is N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-methyl-4-(tetrazol-1-yl)benzenesulfonamide.
| Compound Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-methyl-4-(tetrazol-1-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 51687107 |
| Molecular Formula | C22H21N5O3S |
| Molecular Weight | 435.51 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | N-[(S)-(4-methoxyphenyl)-phenylmethyl]-3-methyl-4-(tetrazol-1-yl)benzenesulfonamide |
| SMILES | COc1ccc([C@@H](NS(=O)(=O)c2ccc(-n3cnnn3)c(C)c2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N5O3S/c1-16-14-20(12-13-21(16)27-15-23-25-26-27)31(28,29)24-22(17-6-4-3-5-7-17)18-8-10-19(30-2)11-9-18/h3-15,22,24H,1-2H3/t22-/m0/s1 |
| InChIKey | VFZURQHQGZGTFV-QFIPXVFZSA-N |
| XLogP | 3.05 |
| TPSA | 99.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.51 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |