C20H23N5O4S — CID 23610235
4-(4-methoxyphenoxy)-1-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperidine (PubChem CID 23610235) has the molecular formula C20H23N5O4S and a molecular weight of 429.50 g/mol. Its IUPAC name is 4-(4-methoxyphenoxy)-1-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperidine.
| Compound Name | 4-(4-methoxyphenoxy)-1-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperidine |
|---|---|
| PubChem CID | 23610235 |
| Molecular Formula | C20H23N5O4S |
| Molecular Weight | 429.50 g/mol |
| Exact Mass | 429.15 |
| IUPAC Name | 4-(4-methoxyphenoxy)-1-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperidine |
| SMILES | COc1ccc(OC2CCN(S(=O)(=O)c3ccc(-n4cnnn4)c(C)c3)CC2)cc1 |
| InChI | InChI=1S/C20H23N5O4S/c1-15-13-19(7-8-20(15)25-14-21-22-23-25)30(26,27)24-11-9-18(10-12-24)29-17-5-3-16(28-2)4-6-17/h3-8,13-14,18H,9-12H2,1-2H3 |
| InChIKey | ZUYVIAPHNCKEFR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 99.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.50 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |