C14H19N5O3S — CID 858983
1-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonylazepane (PubChem CID 858983) has the molecular formula C14H19N5O3S and a molecular weight of 337.41 g/mol. Its IUPAC name is 1-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonylazepane.
| Compound Name | 1-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonylazepane |
|---|---|
| PubChem CID | 858983 |
| Molecular Formula | C14H19N5O3S |
| Molecular Weight | 337.41 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 1-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonylazepane |
| SMILES | COc1cc(S(=O)(=O)N2CCCCCC2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C14H19N5O3S/c1-22-14-10-12(6-7-13(14)19-11-15-16-17-19)23(20,21)18-8-4-2-3-5-9-18/h6-7,10-11H,2-5,8-9H2,1H3 |
| InChIKey | IANQVUKPSLMWSM-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 90.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.41 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |