C15H20N6O3S — CID 654021
2-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 654021) has the molecular formula C15H20N6O3S and a molecular weight of 364.43 g/mol. Its IUPAC name is 2-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 654021 |
| Molecular Formula | C15H20N6O3S |
| Molecular Weight | 364.43 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-[3-methoxy-4-(tetrazol-1-yl)phenyl]sulfonyl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | COc1cc(S(=O)(=O)N2CCN3CCCC3C2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C15H20N6O3S/c1-24-15-9-13(4-5-14(15)21-11-16-17-18-21)25(22,23)20-8-7-19-6-2-3-12(19)10-20/h4-5,9,11-12H,2-3,6-8,10H2,1H3 |
| InChIKey | DFIBKCJIADHORF-UHFFFAOYSA-N |
| XLogP | 0.14 |
| TPSA | 93.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.43 |
| LogP ≤ 5 | 0.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |