C20H31N3O4S2 — CID 23856941
4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-N-cyclohexyl-N-methylbenzenesulfonamide (PubChem CID 23856941) has the molecular formula C20H31N3O4S2 and a molecular weight of 441.62 g/mol. Its IUPAC name is 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-N-cyclohexyl-N-methylbenzenesulfonamide.
| Compound Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-N-cyclohexyl-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 23856941 |
| Molecular Formula | C20H31N3O4S2 |
| Molecular Weight | 441.62 g/mol |
| Exact Mass | 441.18 |
| IUPAC Name | 4-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-ylsulfonyl)-N-cyclohexyl-N-methylbenzenesulfonamide |
| SMILES | CN(C1CCCCC1)S(=O)(=O)c1ccc(S(=O)(=O)N2CCN3CCCC3C2)cc1 |
| InChI | InChI=1S/C20H31N3O4S2/c1-21(17-6-3-2-4-7-17)28(24,25)19-9-11-20(12-10-19)29(26,27)23-15-14-22-13-5-8-18(22)16-23/h9-12,17-18H,2-8,13-16H2,1H3 |
| InChIKey | LOFRBKIGABVNRR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.62 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |