C18H29N3O4S2 — CID 1168545
4-(4-cyclohexylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide (PubChem CID 1168545) has the molecular formula C18H29N3O4S2 and a molecular weight of 415.58 g/mol. Its IUPAC name is 4-(4-cyclohexylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-(4-cyclohexylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1168545 |
| Molecular Formula | C18H29N3O4S2 |
| Molecular Weight | 415.58 g/mol |
| Exact Mass | 415.16 |
| IUPAC Name | 4-(4-cyclohexylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(S(=O)(=O)N2CCN(C3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C18H29N3O4S2/c1-19(2)26(22,23)17-8-10-18(11-9-17)27(24,25)21-14-12-20(13-15-21)16-6-4-3-5-7-16/h8-11,16H,3-7,12-15H2,1-2H3 |
| InChIKey | USWVZWHCQIEETF-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.58 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |