C14H23N3O4S2 — CID 1168552
4-(4-ethylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide (PubChem CID 1168552) has the molecular formula C14H23N3O4S2 and a molecular weight of 361.49 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide.
| Compound Name | 4-(4-ethylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 1168552 |
| Molecular Formula | C14H23N3O4S2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)sulfonyl-N,N-dimethylbenzenesulfonamide |
| SMILES | CCN1CCN(S(=O)(=O)c2ccc(S(=O)(=O)N(C)C)cc2)CC1 |
| InChI | InChI=1S/C14H23N3O4S2/c1-4-16-9-11-17(12-10-16)23(20,21)14-7-5-13(6-8-14)22(18,19)15(2)3/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | ZDABWOOGMJJIQK-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 78.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |