C13H18N6O4S2 — CID 23610585
1-methylsulfonyl-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine (PubChem CID 23610585) has the molecular formula C13H18N6O4S2 and a molecular weight of 386.46 g/mol. Its IUPAC name is 1-methylsulfonyl-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine.
| Compound Name | 1-methylsulfonyl-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine |
|---|---|
| PubChem CID | 23610585 |
| Molecular Formula | C13H18N6O4S2 |
| Molecular Weight | 386.46 g/mol |
| Exact Mass | 386.08 |
| IUPAC Name | 1-methylsulfonyl-4-[3-methyl-4-(tetrazol-1-yl)phenyl]sulfonylpiperazine |
| SMILES | Cc1cc(S(=O)(=O)N2CCN(S(C)(=O)=O)CC2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C13H18N6O4S2/c1-11-9-12(3-4-13(11)19-10-14-15-16-19)25(22,23)18-7-5-17(6-8-18)24(2,20)21/h3-4,9-10H,5-8H2,1-2H3 |
| InChIKey | CVOJYIOTKLTKBZ-UHFFFAOYSA-N |
| XLogP | -0.76 |
| TPSA | 118.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.46 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |