About N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide
N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide (PubChem CID 49189548) has the molecular formula C19H23N5O2S
and a molecular weight of 385.49 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide.
Molecular Properties
| Compound Name | N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide |
| PubChem CID | 49189548 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)N(C)c2ccc(C(C)(C)C)cc2)ccc1-n1cnnn1 |
| InChI | InChI=1S/C19H23N5O2S/c1-14-12-17(10-11-18(14)24-13-20-21-22-24)27(25,26)23(5)16-8-6-15(7-9-16)19(2,3)4/h6-13H,1-5H3 |
| InChIKey | UNFFFGSLWWTBQP-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 80.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide?
The IUPAC name of N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide (CID 49189548) is N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide.
What is the SMILES notation for N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide?
The canonical SMILES for N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide is Cc1cc(S(=O)(=O)N(C)c2ccc(C(C)(C)C)cc2)ccc1-n1cnnn1.
What is the InChIKey of N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide?
The InChIKey is UNFFFGSLWWTBQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5O2S/c1-14-12-17(10-11-18(14)24-13-20-21-22-24)27(25,26)23(5)16-8-6-15(7-9-16)19(2,3)4/h6-13H,1-5H3.
What are the key properties of N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide?
N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide has a molecular weight of 385.49 g/mol, XLogP of 3.09, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-tert-butylphenyl)-N,3-dimethyl-4-(tetrazol-1-yl)benzenesulfonamide is sourced from PubChem (CID 49189548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).