C15H18N2O2S — CID 28941396
N-(4-aminophenyl)-N,3,4-trimethylbenzenesulfonamide (PubChem CID 28941396) has the molecular formula C15H18N2O2S and a molecular weight of 290.39 g/mol. Its IUPAC name is N-(4-aminophenyl)-N,3,4-trimethylbenzenesulfonamide.
| Compound Name | N-(4-aminophenyl)-N,3,4-trimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 28941396 |
| Molecular Formula | C15H18N2O2S |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | N-(4-aminophenyl)-N,3,4-trimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(N)cc2)cc1C |
| InChI | InChI=1S/C15H18N2O2S/c1-11-4-9-15(10-12(11)2)20(18,19)17(3)14-7-5-13(16)6-8-14/h4-10H,16H2,1-3H3 |
| InChIKey | LGCDWYGCKHYADJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|