C15H17NO2S — CID 800890
N,4-dimethyl-N-(4-methylphenyl)benzenesulfonamide (PubChem CID 800890) has the molecular formula C15H17NO2S and a molecular weight of 275.37 g/mol. Its IUPAC name is N,4-dimethyl-N-(4-methylphenyl)benzenesulfonamide.
| Compound Name | N,4-dimethyl-N-(4-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 800890 |
| Molecular Formula | C15H17NO2S |
| Molecular Weight | 275.37 g/mol |
| Exact Mass | 275.10 |
| IUPAC Name | N,4-dimethyl-N-(4-methylphenyl)benzenesulfonamide |
| SMILES | Cc1ccc(N(C)S(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C15H17NO2S/c1-12-4-8-14(9-5-12)16(3)19(17,18)15-10-6-13(2)7-11-15/h4-11H,1-3H3 |
| InChIKey | AFMKTQHRDBNAKW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.37 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |