C14H13F2NO2S — CID 47387538
N-(3,4-difluorophenyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 47387538) has the molecular formula C14H13F2NO2S and a molecular weight of 297.33 g/mol. Its IUPAC name is N-(3,4-difluorophenyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(3,4-difluorophenyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 47387538 |
| Molecular Formula | C14H13F2NO2S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.06 |
| IUPAC Name | N-(3,4-difluorophenyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C14H13F2NO2S/c1-10-3-6-12(7-4-10)20(18,19)17(2)11-5-8-13(15)14(16)9-11/h3-9H,1-2H3 |
| InChIKey | SVTKBTWABWYKFM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |