C15H16ClNO3S — CID 99629001
N-(3-chloro-4-methoxyphenyl)-N,4-dimethylbenzenesulfonamide (PubChem CID 99629001) has the molecular formula C15H16ClNO3S and a molecular weight of 325.82 g/mol. Its IUPAC name is N-(3-chloro-4-methoxyphenyl)-N,4-dimethylbenzenesulfonamide.
| Compound Name | N-(3-chloro-4-methoxyphenyl)-N,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 99629001 |
| Molecular Formula | C15H16ClNO3S |
| Molecular Weight | 325.82 g/mol |
| Exact Mass | 325.05 |
| IUPAC Name | N-(3-chloro-4-methoxyphenyl)-N,4-dimethylbenzenesulfonamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2ccc(C)cc2)cc1Cl |
| InChI | InChI=1S/C15H16ClNO3S/c1-11-4-7-13(8-5-11)21(18,19)17(2)12-6-9-15(20-3)14(16)10-12/h4-10H,1-3H3 |
| InChIKey | FNMWSPDFBKDDRM-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.82 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |