C14H16ClN3O5S2 — CID 71945594
4-chloro-N-[3-(hydrazinesulfonyl)-4-methoxyphenyl]-N-methylbenzenesulfonamide (PubChem CID 71945594) has the molecular formula C14H16ClN3O5S2 and a molecular weight of 405.89 g/mol. Its IUPAC name is 4-chloro-N-[3-(hydrazinesulfonyl)-4-methoxyphenyl]-N-methylbenzenesulfonamide.
| Compound Name | 4-chloro-N-[3-(hydrazinesulfonyl)-4-methoxyphenyl]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 71945594 |
| Molecular Formula | C14H16ClN3O5S2 |
| Molecular Weight | 405.89 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 4-chloro-N-[3-(hydrazinesulfonyl)-4-methoxyphenyl]-N-methylbenzenesulfonamide |
| SMILES | COc1ccc(N(C)S(=O)(=O)c2ccc(Cl)cc2)cc1S(=O)(=O)NN |
| InChI | InChI=1S/C14H16ClN3O5S2/c1-18(25(21,22)12-6-3-10(15)4-7-12)11-5-8-13(23-2)14(9-11)24(19,20)17-16/h3-9,17H,16H2,1-2H3 |
| InChIKey | PSDNRYHNAZIMMY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.89 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|