About CID 70601990
CID 70601990 (PubChem CID 70601990) has the molecular formula C8H10ClNNaO3S
and a molecular weight of 258.68 g/mol.
Molecular Properties
| Compound Name | CID 70601990 |
| PubChem CID | 70601990 |
| Molecular Formula | C8H10ClNNaO3S |
| Molecular Weight | 258.68 g/mol |
| Exact Mass | 258.00 |
| IUPAC Name | — |
| SMILES | CNS(=O)(=O)c1cc(Cl)ccc1OC.[Na] |
| InChI | InChI=1S/C8H10ClNO3S.Na/c1-10-14(11,12)8-5-6(9)3-4-7(8)13-2;/h3-5,10H,1-2H3; |
| InChIKey | DKVNIQQIKYSLMR-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.68 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze CID 70601990 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 70601990?
The IUPAC name of CID 70601990 (CID 70601990) is not available.
What is the SMILES notation for CID 70601990?
The canonical SMILES for CID 70601990 is CNS(=O)(=O)c1cc(Cl)ccc1OC.[Na].
What is the InChIKey of CID 70601990?
The InChIKey is DKVNIQQIKYSLMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10ClNO3S.Na/c1-10-14(11,12)8-5-6(9)3-4-7(8)13-2;/h3-5,10H,1-2H3;.
What are the key properties of CID 70601990?
CID 70601990 has a molecular weight of 258.68 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 70601990 is sourced from PubChem (CID 70601990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).