C10H14ClNO3S — CID 2234484
5-chloro-2-methoxy-N-propylbenzenesulfonamide (PubChem CID 2234484) has the molecular formula C10H14ClNO3S and a molecular weight of 263.75 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-propylbenzenesulfonamide.
| Compound Name | 5-chloro-2-methoxy-N-propylbenzenesulfonamide |
|---|---|
| PubChem CID | 2234484 |
| Molecular Formula | C10H14ClNO3S |
| Molecular Weight | 263.75 g/mol |
| Exact Mass | 263.04 |
| IUPAC Name | 5-chloro-2-methoxy-N-propylbenzenesulfonamide |
| SMILES | CCCNS(=O)(=O)c1cc(Cl)ccc1OC |
| InChI | InChI=1S/C10H14ClNO3S/c1-3-6-12-16(13,14)10-7-8(11)4-5-9(10)15-2/h4-5,7,12H,3,6H2,1-2H3 |
| InChIKey | MFAARGHJJDNVHJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.75 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |