C8H11ClN2O4S2 — CID 124926790
4-chloro-1-N,2-N-dimethylbenzene-1,2-disulfonamide (PubChem CID 124926790) has the molecular formula C8H11ClN2O4S2 and a molecular weight of 298.77 g/mol. Its IUPAC name is 4-chloro-1-N,2-N-dimethylbenzene-1,2-disulfonamide.
| Compound Name | 4-chloro-1-N,2-N-dimethylbenzene-1,2-disulfonamide |
|---|---|
| PubChem CID | 124926790 |
| Molecular Formula | C8H11ClN2O4S2 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 297.98 |
| IUPAC Name | 4-chloro-1-N,2-N-dimethylbenzene-1,2-disulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Cl)cc1S(=O)(=O)NC |
| InChI | InChI=1S/C8H11ClN2O4S2/c1-10-16(12,13)7-4-3-6(9)5-8(7)17(14,15)11-2/h3-5,10-11H,1-2H3 |
| InChIKey | LOHCSOJMZPZADK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |