C13H13Cl2N3O2S — CID 80640845
2-amino-4-(2,5-dichloroanilino)-N-methylbenzenesulfonamide (PubChem CID 80640845) has the molecular formula C13H13Cl2N3O2S and a molecular weight of 346.24 g/mol. Its IUPAC name is 2-amino-4-(2,5-dichloroanilino)-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-4-(2,5-dichloroanilino)-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 80640845 |
| Molecular Formula | C13H13Cl2N3O2S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 345.01 |
| IUPAC Name | 2-amino-4-(2,5-dichloroanilino)-N-methylbenzenesulfonamide |
| SMILES | CNS(=O)(=O)c1ccc(Nc2cc(Cl)ccc2Cl)cc1N |
| InChI | InChI=1S/C13H13Cl2N3O2S/c1-17-21(19,20)13-5-3-9(7-11(13)16)18-12-6-8(14)2-4-10(12)15/h2-7,17-18H,16H2,1H3 |
| InChIKey | YAHCWBFHLSDAKM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|