C13H19N5O2S — CID 107462202
2-amino-4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-N-methylbenzenesulfonamide (PubChem CID 107462202) has the molecular formula C13H19N5O2S and a molecular weight of 309.40 g/mol. Its IUPAC name is 2-amino-4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-N-methylbenzenesulfonamide.
| Compound Name | 2-amino-4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 107462202 |
| Molecular Formula | C13H19N5O2S |
| Molecular Weight | 309.40 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 2-amino-4-[(3-ethyl-1-methylpyrazol-4-yl)amino]-N-methylbenzenesulfonamide |
| SMILES | CCc1nn(C)cc1Nc1ccc(S(=O)(=O)NC)c(N)c1 |
| InChI | InChI=1S/C13H19N5O2S/c1-4-11-12(8-18(3)17-11)16-9-5-6-13(10(14)7-9)21(19,20)15-2/h5-8,15-16H,4,14H2,1-3H3 |
| InChIKey | JGQQWRIBVJVKLZ-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 102.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|