C12H17N5O2S — CID 107462094
4-amino-3-[(3-ethyl-1-methylpyrazol-4-yl)amino]benzenesulfonamide (PubChem CID 107462094) has the molecular formula C12H17N5O2S and a molecular weight of 295.37 g/mol. Its IUPAC name is 4-amino-3-[(3-ethyl-1-methylpyrazol-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-amino-3-[(3-ethyl-1-methylpyrazol-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 107462094 |
| Molecular Formula | C12H17N5O2S |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 4-amino-3-[(3-ethyl-1-methylpyrazol-4-yl)amino]benzenesulfonamide |
| SMILES | CCc1nn(C)cc1Nc1cc(S(N)(=O)=O)ccc1N |
| InChI | InChI=1S/C12H17N5O2S/c1-3-10-12(7-17(2)16-10)15-11-6-8(20(14,18)19)4-5-9(11)13/h4-7,15H,3,13H2,1-2H3,(H2,14,18,19) |
| InChIKey | CRLABJSXXCNUHW-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|