C11H15N5O2S — CID 102803689
3-amino-4-[(1,3-dimethylpyrazol-4-yl)amino]benzenesulfonamide (PubChem CID 102803689) has the molecular formula C11H15N5O2S and a molecular weight of 281.34 g/mol. Its IUPAC name is 3-amino-4-[(1,3-dimethylpyrazol-4-yl)amino]benzenesulfonamide.
| Compound Name | 3-amino-4-[(1,3-dimethylpyrazol-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 102803689 |
| Molecular Formula | C11H15N5O2S |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 3-amino-4-[(1,3-dimethylpyrazol-4-yl)amino]benzenesulfonamide |
| SMILES | Cc1nn(C)cc1Nc1ccc(S(N)(=O)=O)cc1N |
| InChI | InChI=1S/C11H15N5O2S/c1-7-11(6-16(2)15-7)14-10-4-3-8(5-9(10)12)19(13,17)18/h3-6,14H,12H2,1-2H3,(H2,13,17,18) |
| InChIKey | WXURPGOSLKVFCO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|