C12H13N5 — CID 102803725
5-amino-2-[(1,3-dimethylpyrazol-4-yl)amino]benzonitrile (PubChem CID 102803725) has the molecular formula C12H13N5 and a molecular weight of 227.27 g/mol. Its IUPAC name is 5-amino-2-[(1,3-dimethylpyrazol-4-yl)amino]benzonitrile.
| Compound Name | 5-amino-2-[(1,3-dimethylpyrazol-4-yl)amino]benzonitrile |
|---|---|
| PubChem CID | 102803725 |
| Molecular Formula | C12H13N5 |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5-amino-2-[(1,3-dimethylpyrazol-4-yl)amino]benzonitrile |
| SMILES | Cc1nn(C)cc1Nc1ccc(N)cc1C#N |
| InChI | InChI=1S/C12H13N5/c1-8-12(7-17(2)16-8)15-11-4-3-10(14)5-9(11)6-13/h3-5,7,15H,14H2,1-2H3 |
| InChIKey | IPLKTHCFUGCLJK-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 79.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|