C12H13F2N3O2S — CID 103894572
N-[4-(difluoromethylsulfonyl)phenyl]-1,3-dimethylpyrazol-4-amine (PubChem CID 103894572) has the molecular formula C12H13F2N3O2S and a molecular weight of 301.32 g/mol. Its IUPAC name is N-[4-(difluoromethylsulfonyl)phenyl]-1,3-dimethylpyrazol-4-amine.
| Compound Name | N-[4-(difluoromethylsulfonyl)phenyl]-1,3-dimethylpyrazol-4-amine |
|---|---|
| PubChem CID | 103894572 |
| Molecular Formula | C12H13F2N3O2S |
| Molecular Weight | 301.32 g/mol |
| Exact Mass | 301.07 |
| IUPAC Name | N-[4-(difluoromethylsulfonyl)phenyl]-1,3-dimethylpyrazol-4-amine |
| SMILES | Cc1nn(C)cc1Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C12H13F2N3O2S/c1-8-11(7-17(2)16-8)15-9-3-5-10(6-4-9)20(18,19)12(13)14/h3-7,12,15H,1-2H3 |
| InChIKey | POLFJWSVJHPGEV-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.32 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |