2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid

C12H12ClN3O2 — CID 102807400

IUPAC2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid
SMILESCc1nn(C)cc1Nc1ccc(C(=O)O)c(Cl)c1
InChIInChI=1S/C12H12ClN3O2/c1-7-11(6-16(2)15-7)14-8-3-4-9(12(17)18)10(13)5-8/h3-6,14H,1-2H3,(H,17,18)
InChIKeyVNENJLILFITVKI-UHFFFAOYSA-N
MW265.70 g/mol
LogP2.82
Rot. Bonds3

About 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid

2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid (PubChem CID 102807400) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid.

Molecular Properties

Compound Name2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid
PubChem CID102807400
Molecular FormulaC12H12ClN3O2
Molecular Weight265.70 g/mol
Exact Mass265.06
IUPAC Name2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid
SMILESCc1nn(C)cc1Nc1ccc(C(=O)O)c(Cl)c1
InChIInChI=1S/C12H12ClN3O2/c1-7-11(6-16(2)15-7)14-8-3-4-9(12(17)18)10(13)5-8/h3-6,14H,1-2H3,(H,17,18)
InChIKeyVNENJLILFITVKI-UHFFFAOYSA-N
XLogP2.82
TPSA67.15 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500265.70
LogP ≤ 52.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid?
The IUPAC name of 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid (CID 102807400) is 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid.
What is the SMILES notation for 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid?
The canonical SMILES for 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid is Cc1nn(C)cc1Nc1ccc(C(=O)O)c(Cl)c1.
What is the InChIKey of 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid?
The InChIKey is VNENJLILFITVKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12ClN3O2/c1-7-11(6-16(2)15-7)14-8-3-4-9(12(17)18)10(13)5-8/h3-6,14H,1-2H3,(H,17,18).
What are the key properties of 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid?
2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid has a molecular weight of 265.70 g/mol, XLogP of 2.82, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid is sourced from PubChem (CID 102807400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).