C12H12ClN3O2 — CID 102807400
2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid (PubChem CID 102807400) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 102807400 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | 2-chloro-4-[(1,3-dimethylpyrazol-4-yl)amino]benzoic acid |
| SMILES | Cc1nn(C)cc1Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C12H12ClN3O2/c1-7-11(6-16(2)15-7)14-8-3-4-9(12(17)18)10(13)5-8/h3-6,14H,1-2H3,(H,17,18) |
| InChIKey | VNENJLILFITVKI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |