C9H8ClN5O2 — CID 63152537
2-chloro-4-[(1-methyltetrazol-5-yl)amino]benzoic acid (PubChem CID 63152537) has the molecular formula C9H8ClN5O2 and a molecular weight of 253.65 g/mol. Its IUPAC name is 2-chloro-4-[(1-methyltetrazol-5-yl)amino]benzoic acid.
| Compound Name | 2-chloro-4-[(1-methyltetrazol-5-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 63152537 |
| Molecular Formula | C9H8ClN5O2 |
| Molecular Weight | 253.65 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-chloro-4-[(1-methyltetrazol-5-yl)amino]benzoic acid |
| SMILES | Cn1nnnc1Nc1ccc(C(=O)O)c(Cl)c1 |
| InChI | InChI=1S/C9H8ClN5O2/c1-15-9(12-13-14-15)11-5-2-3-6(8(16)17)7(10)4-5/h2-4H,1H3,(H,16,17)(H,11,12,14) |
| InChIKey | FAVZJIYSUIXWSH-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.65 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |