About 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane
1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane (PubChem CID 143485097) has the molecular formula C9H11F3O2S
and a molecular weight of 240.25 g/mol. Its IUPAC name is 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane.
Molecular Properties
| Compound Name | 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane |
| PubChem CID | 143485097 |
| Molecular Formula | C9H11F3O2S |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane |
| SMILES | CF.Cc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C8H8F2O2S.CH3F/c1-6-2-4-7(5-3-6)13(11,12)8(9)10;1-2/h2-5,8H,1H3;1H3 |
| InChIKey | UCVWSCOVSRFLBV-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane?
The IUPAC name of 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane (CID 143485097) is 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane.
What is the SMILES notation for 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane?
The canonical SMILES for 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane is CF.Cc1ccc(S(=O)(=O)C(F)F)cc1.
What is the InChIKey of 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane?
The InChIKey is UCVWSCOVSRFLBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F2O2S.CH3F/c1-6-2-4-7(5-3-6)13(11,12)8(9)10;1-2/h2-5,8H,1H3;1H3.
What are the key properties of 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane?
1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane has a molecular weight of 240.25 g/mol, XLogP of 2.58, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(difluoromethylsulfonyl)-4-methylbenzene;fluoromethane is sourced from PubChem (CID 143485097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).